C18H18ClFN2O3S — CID 4312654
1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)piperidine-2-carboxamide (PubChem CID 4312654) has the molecular formula C18H18ClFN2O3S and a molecular weight of 396.87 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 4312654 |
| Molecular Formula | C18H18ClFN2O3S |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18ClFN2O3S/c19-15-12-13(9-10-16(15)20)21-18(23)17-8-4-5-11-22(17)26(24,25)14-6-2-1-3-7-14/h1-3,6-7,9-10,12,17H,4-5,8,11H2,(H,21,23) |
| InChIKey | XANNVEAYCWYUAC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |