C17H16ClFN2O3S — CID 40830483
(2R)-1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 40830483) has the molecular formula C17H16ClFN2O3S and a molecular weight of 382.84 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 40830483 |
| Molecular Formula | C17H16ClFN2O3S |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)[C@H]1CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16ClFN2O3S/c18-14-11-12(8-9-15(14)19)20-17(22)16-7-4-10-21(16)25(23,24)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,16H,4,7,10H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | PQDSXJRERRVTAV-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |