C20H20Cl2N2O4S — CID 60539561
1-(3-acetylphenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide (PubChem CID 60539561) has the molecular formula C20H20Cl2N2O4S and a molecular weight of 455.36 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 60539561 |
| Molecular Formula | C20H20Cl2N2O4S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCCCC2C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H20Cl2N2O4S/c1-13(25)14-5-4-6-16(11-14)29(27,28)24-10-3-2-7-19(24)20(26)23-15-8-9-17(21)18(22)12-15/h4-6,8-9,11-12,19H,2-3,7,10H2,1H3,(H,23,26) |
| InChIKey | FMOCCOHZMZNMIY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |