C19H20N2O5S — CID 8018672
(2S)-1-(benzenesulfonyl)-N-(1,3-benzodioxol-5-yl)piperidine-2-carboxamide (PubChem CID 8018672) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-N-(1,3-benzodioxol-5-yl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-(benzenesulfonyl)-N-(1,3-benzodioxol-5-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 8018672 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-N-(1,3-benzodioxol-5-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O5S/c22-19(20-14-9-10-17-18(12-14)26-13-25-17)16-8-4-5-11-21(16)27(23,24)15-6-2-1-3-7-15/h1-3,6-7,9-10,12,16H,4-5,8,11,13H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | BZWSKATURMSRRQ-INIZCTEOSA-N |
| XLogP | 2.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |