C24H25N3O3S — CID 112803511
1-(benzenesulfonyl)-N-[4-(pyridin-4-ylmethyl)phenyl]piperidine-2-carboxamide (PubChem CID 112803511) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-(pyridin-4-ylmethyl)phenyl]piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-(pyridin-4-ylmethyl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 112803511 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-(pyridin-4-ylmethyl)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3S/c28-24(26-21-11-9-19(10-12-21)18-20-13-15-25-16-14-20)23-8-4-5-17-27(23)31(29,30)22-6-2-1-3-7-22/h1-3,6-7,9-16,23H,4-5,8,17-18H2,(H,26,28) |
| InChIKey | QCQTWRSUFYXMEX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |