C24H25N3O3S2 — CID 55468628
1-(benzenesulfonyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-2-carboxamide (PubChem CID 55468628) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55468628 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3S2/c28-24(23-10-4-5-16-27(23)32(29,30)22-8-2-1-3-9-22)26-20-11-13-21(14-12-20)31-18-19-7-6-15-25-17-19/h1-3,6-9,11-15,17,23H,4-5,10,16,18H2,(H,26,28) |
| InChIKey | IYFDIWIUYGNEOG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |