C24H24N4O3S — CID 46668940
1-(2-nitrophenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide (PubChem CID 46668940) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-nitrophenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46668940 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-(2-nitrophenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H24N4O3S/c29-24(19-11-14-27(15-12-19)22-5-1-2-6-23(22)28(30)31)26-20-7-9-21(10-8-20)32-17-18-4-3-13-25-16-18/h1-10,13,16,19H,11-12,14-15,17H2,(H,26,29) |
| InChIKey | BHTSIEHBMTVAIZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|