C18H19BrN4O3 — CID 133453814
1-(5-bromo-2-nitrophenyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 133453814) has the molecular formula C18H19BrN4O3 and a molecular weight of 419.28 g/mol. Its IUPAC name is 1-(5-bromo-2-nitrophenyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromo-2-nitrophenyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133453814 |
| Molecular Formula | C18H19BrN4O3 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-(5-bromo-2-nitrophenyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(c2cc(Br)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H19BrN4O3/c19-15-3-4-16(23(25)26)17(10-15)22-8-5-14(6-9-22)18(24)21-12-13-2-1-7-20-11-13/h1-4,7,10-11,14H,5-6,8-9,12H2,(H,21,24) |
| InChIKey | SZWSQQOTKMFVLE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|