C13H18N4O2 — CID 71166492
4-N-(pyridin-3-ylmethyl)piperidine-1,4-dicarboxamide (PubChem CID 71166492) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-N-(pyridin-3-ylmethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(pyridin-3-ylmethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 71166492 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-N-(pyridin-3-ylmethyl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)N1CCC(C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C13H18N4O2/c14-13(19)17-6-3-11(4-7-17)12(18)16-9-10-2-1-5-15-8-10/h1-2,5,8,11H,3-4,6-7,9H2,(H2,14,19)(H,16,18) |
| InChIKey | ZOKUMJBUAZPUDI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |