C17H16F4N4O — CID 133371811
N-(pyridin-3-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 133371811) has the molecular formula C17H16F4N4O and a molecular weight of 368.33 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(pyridin-3-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133371811 |
| Molecular Formula | C17H16F4N4O |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C17H16F4N4O/c18-12-14(13(19)16(21)24-15(12)20)25-6-3-11(4-7-25)17(26)23-9-10-2-1-5-22-8-10/h1-2,5,8,11H,3-4,6-7,9H2,(H,23,26) |
| InChIKey | PXHYKNVHYKBMMF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|