C21H20ClFN4O — CID 133453904
1-(4-chloro-8-fluoroquinolin-7-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 133453904) has the molecular formula C21H20ClFN4O and a molecular weight of 398.87 g/mol. Its IUPAC name is 1-(4-chloro-8-fluoroquinolin-7-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chloro-8-fluoroquinolin-7-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133453904 |
| Molecular Formula | C21H20ClFN4O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-(4-chloro-8-fluoroquinolin-7-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(c2ccc3c(Cl)ccnc3c2F)CC1 |
| InChI | InChI=1S/C21H20ClFN4O/c22-17-5-9-25-20-16(17)3-4-18(19(20)23)27-10-6-15(7-11-27)21(28)26-13-14-2-1-8-24-12-14/h1-5,8-9,12,15H,6-7,10-11,13H2,(H,26,28) |
| InChIKey | OYAFBMCPNBSKKI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |