C17H19ClN4O — CID 133453933
1-(2-chloro-4-pyridinyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 133453933) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-chloro-4-pyridinyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133453933 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19ClN4O/c18-16-10-15(3-7-20-16)22-8-4-14(5-9-22)17(23)21-12-13-2-1-6-19-11-13/h1-3,6-7,10-11,14H,4-5,8-9,12H2,(H,21,23) |
| InChIKey | MLWOXRUEHKJXHX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|