C15H22ClN3O — CID 133373804
N-butyl-1-(2-chloro-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 133373804) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is N-butyl-1-(2-chloro-4-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-butyl-1-(2-chloro-4-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133373804 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-butyl-1-(2-chloro-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22ClN3O/c1-2-3-7-18-15(20)12-5-9-19(10-6-12)13-4-8-17-14(16)11-13/h4,8,11-12H,2-3,5-7,9-10H2,1H3,(H,18,20) |
| InChIKey | MLIQXLDUARPCFS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|