C18H25N3OS — CID 46395507
N-pentyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide (PubChem CID 46395507) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is N-pentyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide.
| Compound Name | N-pentyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46395507 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-pentyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-3-4-9-20-18(22)14-6-11-21(12-7-14)17-15-8-13-23-16(15)5-10-19-17/h5,8,10,13-14H,2-4,6-7,9,11-12H2,1H3,(H,20,22) |
| InChIKey | NVQYDJAWKUOELG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|