C22H32N4OS — CID 46395530
N-[3-(2-methylpiperidin-1-yl)propyl]-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide (PubChem CID 46395530) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46395530 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)C1CCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C22H32N4OS/c1-17-5-2-3-12-25(17)13-4-10-24-22(27)18-7-14-26(15-8-18)21-19-9-16-28-20(19)6-11-23-21/h6,9,11,16-18H,2-5,7-8,10,12-15H2,1H3,(H,24,27) |
| InChIKey | UIFALMFDLAPKML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|