C25H40N6O — CID 92898904
1-(1-ethyl-3-methylpyrazolo[5,4-c]pyridin-7-yl)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 92898904) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is 1-(1-ethyl-3-methylpyrazolo[5,4-c]pyridin-7-yl)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(1-ethyl-3-methylpyrazolo[5,4-c]pyridin-7-yl)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92898904 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 1-(1-ethyl-3-methylpyrazolo[5,4-c]pyridin-7-yl)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)C1CCN(c2nccc3c(C)nn(CC)c23)CC1 |
| InChI | InChI=1S/C25H40N6O/c1-4-21-9-6-7-15-29(21)16-8-13-27-25(32)20-11-17-30(18-12-20)24-23-22(10-14-26-24)19(3)28-31(23)5-2/h10,14,20-21H,4-9,11-13,15-18H2,1-3H3,(H,27,32)/t21-/m0/s1 |
| InChIKey | NMDDRSOFLZTDHA-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|