C16H25N3O — CID 100629368
N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]pyridine-3-carboxamide (PubChem CID 100629368) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 100629368 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]pyridine-3-carboxamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H25N3O/c1-2-15-8-3-4-11-19(15)12-6-10-18-16(20)14-7-5-9-17-13-14/h5,7,9,13,15H,2-4,6,8,10-12H2,1H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | SPNRBSZGQJPSNA-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|