C24H31N5OS — CID 20883681
N-[3-(2-ethylpiperidin-1-yl)propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide (PubChem CID 20883681) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 20883681 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)benzamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc(CSc2nc3ccncc3[nH]2)cc1 |
| InChI | InChI=1S/C24H31N5OS/c1-2-20-6-3-4-14-29(20)15-5-12-26-23(30)19-9-7-18(8-10-19)17-31-24-27-21-11-13-25-16-22(21)28-24/h7-11,13,16,20H,2-6,12,14-15,17H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | WSKQHJLJHUHLDN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|