C19H30N4O — CID 143609530
N-[3-(2-ethylpiperidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-7-carboxamide (PubChem CID 143609530) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-7-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 143609530 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-1,2,3,4-tetrahydroquinazoline-7-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc2c(c1)NCNC2 |
| InChI | InChI=1S/C19H30N4O/c1-2-17-6-3-4-10-23(17)11-5-9-21-19(24)15-7-8-16-13-20-14-22-18(16)12-15/h7-8,12,17,20,22H,2-6,9-11,13-14H2,1H3,(H,21,24) |
| InChIKey | FDWKLEFJSKPLSY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|