C26H31FN4O3 — CID 24804900
N-[3-(2-ethylpiperidin-1-yl)propyl]-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1H-quinazoline-7-carboxamide (PubChem CID 24804900) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1H-quinazoline-7-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24804900 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-[(3-fluorophenyl)methyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc2c(=O)n(Cc3cccc(F)c3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H31FN4O3/c1-2-21-9-3-4-13-30(21)14-6-12-28-24(32)19-10-11-22-23(16-19)29-26(34)31(25(22)33)17-18-7-5-8-20(27)15-18/h5,7-8,10-11,15-16,21H,2-4,6,9,12-14,17H2,1H3,(H,28,32)(H,29,34) |
| InChIKey | BTRRUKAWLHIOMQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|