C24H28FN5O3 — CID 24804732
3-[(3-fluorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-2,4-dioxo-1H-quinazoline-7-carboxamide (PubChem CID 24804732) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-2,4-dioxo-1H-quinazoline-7-carboxamide.
| Compound Name | 3-[(3-fluorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24804732 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc3c(=O)n(Cc4cccc(F)c4)c(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C24H28FN5O3/c1-28-10-12-29(13-11-28)9-3-8-26-22(31)18-6-7-20-21(15-18)27-24(33)30(23(20)32)16-17-4-2-5-19(25)14-17/h2,4-7,14-15H,3,8-13,16H2,1H3,(H,26,31)(H,27,33) |
| InChIKey | ZODSPFXUPNRTCL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|