C24H28BrN5O2S — CID 6616320
4-[(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide (PubChem CID 6616320) has the molecular formula C24H28BrN5O2S and a molecular weight of 530.49 g/mol. Its IUPAC name is 4-[(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-[(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 6616320 |
| Molecular Formula | C24H28BrN5O2S |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 4-[(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]benzamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc(Cn3c(=S)[nH]c4ccc(Br)cc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H28BrN5O2S/c1-28-11-13-29(14-12-28)10-2-9-26-22(31)18-5-3-17(4-6-18)16-30-23(32)20-15-19(25)7-8-21(20)27-24(30)33/h3-8,15H,2,9-14,16H2,1H3,(H,26,31)(H,27,33) |
| InChIKey | GXZUGBUSRJHXJW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|