C20H21ClN4O2S — CID 4597377
3-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 4597377) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4597377 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc2c(=O)n(Cc3ccc(Cl)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C20H21ClN4O2S/c1-24(2)10-9-22-18(26)14-5-8-16-17(11-14)23-20(28)25(19(16)27)12-13-3-6-15(21)7-4-13/h3-8,11H,9-10,12H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | NIJFRYNRMDOHQG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|