C20H18ClN3O2S2 — CID 27883906
N-[2-(4-chlorophenyl)sulfanylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 27883906) has the molecular formula C20H18ClN3O2S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 27883906 |
| Molecular Formula | C20H18ClN3O2S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NCCSc3ccc(Cl)cc3)ccc2c1=O |
| InChI | InChI=1S/C20H18ClN3O2S2/c1-2-10-24-19(26)16-8-3-13(12-17(16)23-20(24)27)18(25)22-9-11-28-15-6-4-14(21)5-7-15/h2-8,12H,1,9-11H2,(H,22,25)(H,23,27) |
| InChIKey | LVWUMXYVDBQKBE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|