C22H19N3O2S2 — CID 87020530
N-[2-(1-benzothiophen-3-yl)ethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 87020530) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 87020530 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NCCc3csc4ccccc34)ccc2c1=O |
| InChI | InChI=1S/C22H19N3O2S2/c1-2-11-25-21(27)17-8-7-14(12-18(17)24-22(25)28)20(26)23-10-9-15-13-29-19-6-4-3-5-16(15)19/h2-8,12-13H,1,9-11H2,(H,23,26)(H,24,28) |
| InChIKey | ZICYWTMHRABBTR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|