C20H19N3O3 — CID 3297643
2,4-dioxo-N-(2-phenylethyl)-3-prop-2-enyl-1H-quinazoline-7-carboxamide (PubChem CID 3297643) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2,4-dioxo-N-(2-phenylethyl)-3-prop-2-enyl-1H-quinazoline-7-carboxamide.
| Compound Name | 2,4-dioxo-N-(2-phenylethyl)-3-prop-2-enyl-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 3297643 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2,4-dioxo-N-(2-phenylethyl)-3-prop-2-enyl-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=O)[nH]c2cc(C(=O)NCCc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C20H19N3O3/c1-2-12-23-19(25)16-9-8-15(13-17(16)22-20(23)26)18(24)21-11-10-14-6-4-3-5-7-14/h2-9,13H,1,10-12H2,(H,21,24)(H,22,26) |
| InChIKey | VIHIBODLRYVWSG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|