C20H19N3O3 — CID 22423244
N-cyclopropyl-2,4-dioxo-3-(2-phenylethyl)-1H-quinazoline-7-carboxamide (PubChem CID 22423244) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-cyclopropyl-2,4-dioxo-3-(2-phenylethyl)-1H-quinazoline-7-carboxamide.
| Compound Name | N-cyclopropyl-2,4-dioxo-3-(2-phenylethyl)-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 22423244 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-cyclopropyl-2,4-dioxo-3-(2-phenylethyl)-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(=O)n(CCc3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H19N3O3/c24-18(21-15-7-8-15)14-6-9-16-17(12-14)22-20(26)23(19(16)25)11-10-13-4-2-1-3-5-13/h1-6,9,12,15H,7-8,10-11H2,(H,21,24)(H,22,26) |
| InChIKey | JXPQJKGYIZOGDL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |