C28H30N4O2 — CID 3232154
N-(1-benzylpiperidin-4-yl)-2-oxo-1-(2-phenylethyl)-3H-benzimidazole-5-carboxamide (PubChem CID 3232154) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-oxo-1-(2-phenylethyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-oxo-1-(2-phenylethyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3232154 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-oxo-1-(2-phenylethyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1ccc2c(c1)[nH]c(=O)n2CCc1ccccc1 |
| InChI | InChI=1S/C28H30N4O2/c33-27(29-24-14-16-31(17-15-24)20-22-9-5-2-6-10-22)23-11-12-26-25(19-23)30-28(34)32(26)18-13-21-7-3-1-4-8-21/h1-12,19,24H,13-18,20H2,(H,29,33)(H,30,34) |
| InChIKey | HSPZEJIJFALZEA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |