C23H18ClN3O2S2 — CID 55866568
N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55866568) has the molecular formula C23H18ClN3O2S2 and a molecular weight of 468.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55866568 |
| Molecular Formula | C23H18ClN3O2S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NC(c3ccc(Cl)cc3)c3cccs3)ccc2c1=O |
| InChI | InChI=1S/C23H18ClN3O2S2/c1-2-11-27-22(29)17-10-7-15(13-18(17)25-23(27)30)21(28)26-20(19-4-3-12-31-19)14-5-8-16(24)9-6-14/h2-10,12-13,20H,1,11H2,(H,25,30)(H,26,28) |
| InChIKey | KMHWNRCAEDHIBT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|