C22H24N4O3S2 — CID 25351251
N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 25351251) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 25351251 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NC[C@@H](c3cccs3)N3CCOCC3)ccc2c1=O |
| InChI | InChI=1S/C22H24N4O3S2/c1-2-7-26-21(28)16-6-5-15(13-17(16)24-22(26)30)20(27)23-14-18(19-4-3-12-31-19)25-8-10-29-11-9-25/h2-6,12-13,18H,1,7-11,14H2,(H,23,27)(H,24,30)/t18-/m0/s1 |
| InChIKey | ZLNFSXWNBHFFPT-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|