C24H28N4O5S — CID 30549337
N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 30549337) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 30549337 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-methyl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2ccc3c(=O)n(C)c(=S)[nH]c3c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H28N4O5S/c1-27-23(30)17-6-4-16(12-18(17)26-24(27)34)22(29)25-14-19(28-8-10-33-11-9-28)15-5-7-20(31-2)21(13-15)32-3/h4-7,12-13,19H,8-11,14H2,1-3H3,(H,25,29)(H,26,34)/t19-/m1/s1 |
| InChIKey | QBBUPYAEFDPMTO-LJQANCHMSA-N |
| XLogP | 2.42 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|