C26H36N2O6 — CID 29359882
N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethoxy-4-propoxybenzamide (PubChem CID 29359882) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethoxy-4-propoxybenzamide.
| Compound Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 29359882 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC[C@@H](c2ccc(OC)c(OC)c2)N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C26H36N2O6/c1-5-13-34-23-10-8-20(17-25(23)33-6-2)26(29)27-18-21(28-11-14-32-15-12-28)19-7-9-22(30-3)24(16-19)31-4/h7-10,16-17,21H,5-6,11-15,18H2,1-4H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | UPAXREWTLNBSLA-NRFANRHFSA-N |
| XLogP | 3.69 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |