C20H24ClN3O4 — CID 46525244
2-chloro-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pyridine-4-carboxamide (PubChem CID 46525244) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46525244 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)c2ccnc(Cl)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C20H24ClN3O4/c1-26-17-4-3-14(11-18(17)27-2)16(24-7-9-28-10-8-24)13-23-20(25)15-5-6-22-19(21)12-15/h3-6,11-12,16H,7-10,13H2,1-2H3,(H,23,25) |
| InChIKey | NPBKHKQLNZQUQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|