C25H30N4O5S — CID 30549132
N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 30549132) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 30549132 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | COc1ccc([C@H](CNC(=O)CCn2c(=S)[nH]c3ccccc3c2=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C25H30N4O5S/c1-32-21-8-7-17(15-22(21)33-2)20(28-11-13-34-14-12-28)16-26-23(30)9-10-29-24(31)18-5-3-4-6-19(18)27-25(29)35/h3-8,15,20H,9-14,16H2,1-2H3,(H,26,30)(H,27,35)/t20-/m0/s1 |
| InChIKey | PGMQQVDGOFWCJV-FQEVSTJZSA-N |
| XLogP | 2.66 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|