C19H28N2O4 — CID 95285110
N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pent-4-enamide (PubChem CID 95285110) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pent-4-enamide.
| Compound Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pent-4-enamide |
|---|---|
| PubChem CID | 95285110 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[(2R)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC[C@@H](c1ccc(OC)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H28N2O4/c1-4-5-6-19(22)20-14-16(21-9-11-25-12-10-21)15-7-8-17(23-2)18(13-15)24-3/h4,7-8,13,16H,1,5-6,9-12,14H2,2-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | RETNWTOIHSTWTN-INIZCTEOSA-N |
| XLogP | 2.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|