C25H33ClN2O5 — CID 46448746
4-(4-chloro-3-methylphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide (PubChem CID 46448746) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide |
|---|---|
| PubChem CID | 46448746 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide |
| SMILES | COc1ccc(C(CNC(=O)CCCOc2ccc(Cl)c(C)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C25H33ClN2O5/c1-18-15-20(7-8-21(18)26)33-12-4-5-25(29)27-17-22(28-10-13-32-14-11-28)19-6-9-23(30-2)24(16-19)31-3/h6-9,15-16,22H,4-5,10-14,17H2,1-3H3,(H,27,29) |
| InChIKey | OIMCOUHGGVPGNK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|