C19H33Cl2N3O4 — CID 119830133
N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119830133) has the molecular formula C19H33Cl2N3O4 and a molecular weight of 438.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119830133 |
| Molecular Formula | C19H33Cl2N3O4 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C19H31N3O4.2ClH/c1-20-8-4-5-19(23)21-14-16(22-9-11-26-12-10-22)15-6-7-17(24-2)18(13-15)25-3;;/h6-7,13,16,20H,4-5,8-12,14H2,1-3H3,(H,21,23);2*1H |
| InChIKey | IYSMBDBTJNYQNG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|