C26H33N3O6 — CID 46472197
4-(4-cyano-2-methoxyphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide (PubChem CID 46472197) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide |
|---|---|
| PubChem CID | 46472197 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]butanamide |
| SMILES | COc1ccc(C(CNC(=O)CCCOc2ccc(C#N)cc2OC)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C26H33N3O6/c1-31-22-9-7-20(16-25(22)33-3)21(29-10-13-34-14-11-29)18-28-26(30)5-4-12-35-23-8-6-19(17-27)15-24(23)32-2/h6-9,15-16,21H,4-5,10-14,18H2,1-3H3,(H,28,30) |
| InChIKey | JNQWUKJYWXHVTE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|