C24H29N3O4 — CID 46517704
N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 46517704) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46517704 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | COc1ccc(C(CNC(=O)Cc2c[nH]c3ccccc23)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H29N3O4/c1-29-22-8-7-17(13-23(22)30-2)21(27-9-11-31-12-10-27)16-26-24(28)14-18-15-25-20-6-4-3-5-19(18)20/h3-8,13,15,21,25H,9-12,14,16H2,1-2H3,(H,26,28) |
| InChIKey | IOPCAERKPHZUEK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |