C24H24ClN3O4S — CID 24554384
propan-2-yl 3-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]propanoate (PubChem CID 24554384) has the molecular formula C24H24ClN3O4S and a molecular weight of 485.99 g/mol. Its IUPAC name is propan-2-yl 3-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]propanoate.
| Compound Name | propan-2-yl 3-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 24554384 |
| Molecular Formula | C24H24ClN3O4S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | propan-2-yl 3-(2-chlorophenyl)-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]propanoate |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NC(CC(=O)OC(C)C)c3ccccc3Cl)ccc2c1=O |
| InChI | InChI=1S/C24H24ClN3O4S/c1-4-11-28-23(31)17-10-9-15(12-19(17)27-24(28)33)22(30)26-20(13-21(29)32-14(2)3)16-7-5-6-8-18(16)25/h4-10,12,14,20H,1,11,13H2,2-3H3,(H,26,30)(H,27,33) |
| InChIKey | VEYLMLJHNASLHD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|