C22H22N4O6S — CID 34248036
4-oxo-3-prop-2-enyl-2-sulfanylidene-N'-(3,4,5-trimethoxybenzoyl)-1H-quinazoline-7-carbohydrazide (PubChem CID 34248036) has the molecular formula C22H22N4O6S and a molecular weight of 470.51 g/mol. Its IUPAC name is 4-oxo-3-prop-2-enyl-2-sulfanylidene-N'-(3,4,5-trimethoxybenzoyl)-1H-quinazoline-7-carbohydrazide.
| Compound Name | 4-oxo-3-prop-2-enyl-2-sulfanylidene-N'-(3,4,5-trimethoxybenzoyl)-1H-quinazoline-7-carbohydrazide |
|---|---|
| PubChem CID | 34248036 |
| Molecular Formula | C22H22N4O6S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-oxo-3-prop-2-enyl-2-sulfanylidene-N'-(3,4,5-trimethoxybenzoyl)-1H-quinazoline-7-carbohydrazide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NNC(=O)c3cc(OC)c(OC)c(OC)c3)ccc2c1=O |
| InChI | InChI=1S/C22H22N4O6S/c1-5-8-26-21(29)14-7-6-12(9-15(14)23-22(26)33)19(27)24-25-20(28)13-10-16(30-2)18(32-4)17(11-13)31-3/h5-7,9-11H,1,8H2,2-4H3,(H,23,33)(H,24,27)(H,25,28) |
| InChIKey | HEMRMVWTVYZSLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|