C24H20N4O5S — CID 24553916
4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbohydrazide (PubChem CID 24553916) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbohydrazide.
| Compound Name | 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbohydrazide |
|---|---|
| PubChem CID | 24553916 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbohydrazide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NNC(=O)c3ccc(COc4ccccc4)o3)ccc2c1=O |
| InChI | InChI=1S/C24H20N4O5S/c1-2-12-28-23(31)18-10-8-15(13-19(18)25-24(28)34)21(29)26-27-22(30)20-11-9-17(33-20)14-32-16-6-4-3-5-7-16/h2-11,13H,1,12,14H2,(H,25,34)(H,26,29)(H,27,30) |
| InChIKey | VAZLEJUWHXTOMO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|