C23H21N5O3S — CID 55766995
4-oxo-3-prop-2-enyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55766995) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-oxo-3-prop-2-enyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 4-oxo-3-prop-2-enyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55766995 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-oxo-3-prop-2-enyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)Nc3cccc(OCCn4cccn4)c3)ccc2c1=O |
| InChI | InChI=1S/C23H21N5O3S/c1-2-10-28-22(30)19-8-7-16(14-20(19)26-23(28)32)21(29)25-17-5-3-6-18(15-17)31-13-12-27-11-4-9-24-27/h2-9,11,14-15H,1,10,12-13H2,(H,25,29)(H,26,32) |
| InChIKey | WISPVJWPBVVAIM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|