C22H20ClN5O3S — CID 55663419
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55663419) has the molecular formula C22H20ClN5O3S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55663419 |
| Molecular Formula | C22H20ClN5O3S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)Nc3ccc(N4CCNC(=O)C4)c(Cl)c3)ccc2c1=O |
| InChI | InChI=1S/C22H20ClN5O3S/c1-2-8-28-21(31)15-5-3-13(10-17(15)26-22(28)32)20(30)25-14-4-6-18(16(23)11-14)27-9-7-24-19(29)12-27/h2-6,10-11H,1,7-9,12H2,(H,24,29)(H,25,30)(H,26,32) |
| InChIKey | AUWUBUPJAMMXMH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|