C15H14ClN3O2S — CID 47045237
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-carboxamide (PubChem CID 47045237) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 47045237 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3ccsc3)cc2Cl)CCN1 |
| InChI | InChI=1S/C15H14ClN3O2S/c16-12-7-11(18-15(21)10-3-6-22-9-10)1-2-13(12)19-5-4-17-14(20)8-19/h1-3,6-7,9H,4-5,8H2,(H,17,20)(H,18,21) |
| InChIKey | IYLDLWFTEZUXFJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|