C17H14ClF2N3O2 — CID 154774030
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2,6-difluorobenzamide (PubChem CID 154774030) has the molecular formula C17H14ClF2N3O2 and a molecular weight of 365.77 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 154774030 |
| Molecular Formula | C17H14ClF2N3O2 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3c(F)cccc3F)cc2Cl)CCN1 |
| InChI | InChI=1S/C17H14ClF2N3O2/c18-11-8-10(4-5-14(11)23-7-6-21-15(24)9-23)22-17(25)16-12(19)2-1-3-13(16)20/h1-5,8H,6-7,9H2,(H,21,24)(H,22,25) |
| InChIKey | WGYFYHZZAOWKNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|