C22H23ClFN3O2 — CID 55763363
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 55763363) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55763363 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)C3(c4cccc(F)c4)CCCC3)cc2Cl)CCN1 |
| InChI | InChI=1S/C22H23ClFN3O2/c23-18-13-17(6-7-19(18)27-11-10-25-20(28)14-27)26-21(29)22(8-1-2-9-22)15-4-3-5-16(24)12-15/h3-7,12-13H,1-2,8-11,14H2,(H,25,28)(H,26,29) |
| InChIKey | STRDZUNTMRMQER-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|