C19H16Cl3N3O2 — CID 55663147
(E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,6-dichlorophenyl)prop-2-enamide (PubChem CID 55663147) has the molecular formula C19H16Cl3N3O2 and a molecular weight of 424.72 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,6-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,6-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55663147 |
| Molecular Formula | C19H16Cl3N3O2 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,6-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)Nc1ccc(N2CCNC(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O2/c20-14-2-1-3-15(21)13(14)5-7-18(26)24-12-4-6-17(16(22)10-12)25-9-8-23-19(27)11-25/h1-7,10H,8-9,11H2,(H,23,27)(H,24,26)/b7-5+ |
| InChIKey | SDSGWFWNPPZEDS-FNORWQNLSA-N |
| XLogP | 4.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|