C21H22ClN3O2 — CID 46467837
(E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 46467837) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46467837 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (E)-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccc(N3CCNC(=O)C3)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C21H22ClN3O2/c1-14-3-4-16(15(2)11-14)5-8-20(26)24-17-6-7-19(18(22)12-17)25-10-9-23-21(27)13-25/h3-8,11-12H,9-10,13H2,1-2H3,(H,23,27)(H,24,26)/b8-5+ |
| InChIKey | VXRLHAJJDBECPH-VMPITWQZSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|