C20H27ClN4O4 — CID 55661927
tert-butyl 2-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 55661927) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is tert-butyl 2-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 55661927 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | tert-butyl 2-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)Nc1ccc(N2CCNC(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C20H27ClN4O4/c1-20(2,3)29-19(28)25-9-4-5-16(25)18(27)23-13-6-7-15(14(21)11-13)24-10-8-22-17(26)12-24/h6-7,11,16H,4-5,8-10,12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | DZYFDHYFKKGZMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|